About [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium
[(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium (PubChem CID 2166888) has the molecular formula C15H17N2O2+
and a molecular weight of 257.31 g/mol. Its IUPAC name is [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium.
Molecular Properties
| Compound Name | [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium |
| PubChem CID | 2166888 |
| Molecular Formula | C15H17N2O2+ |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium |
| SMILES | C[NH+](C)/C=C/C=C1\CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H16N2O2/c1-16(2)10-6-7-12-11-14(18)17(15(12)19)13-8-4-3-5-9-13/h3-10H,11H2,1-2H3/p+1/b10-6+,12-7+ |
| InChIKey | SNADLNWTQWDSFM-QXZILWSFSA-O |
| XLogP | 0.53 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium?
The IUPAC name of [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium (CID 2166888) is [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium.
What is the SMILES notation for [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium?
The canonical SMILES for [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium is C[NH+](C)/C=C/C=C1\CC(=O)N(c2ccccc2)C1=O.
What is the InChIKey of [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium?
The InChIKey is SNADLNWTQWDSFM-QXZILWSFSA-O. The full InChI is InChI=1S/C15H16N2O2/c1-16(2)10-6-7-12-11-14(18)17(15(12)19)13-8-4-3-5-9-13/h3-10H,11H2,1-2H3/p+1/b10-6+,12-7+.
What are the key properties of [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium?
[(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium has a molecular weight of 257.31 g/mol, XLogP of 0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium is sourced from PubChem (CID 2166888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).