C15H17N2O2+ — CID 2166888
[(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium (PubChem CID 2166888) has the molecular formula C15H17N2O2+ and a molecular weight of 257.31 g/mol. Its IUPAC name is [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium.
| Compound Name | [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium |
|---|---|
| PubChem CID | 2166888 |
| Molecular Formula | C15H17N2O2+ |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [(E,3E)-3-(2,5-dioxo-1-phenylpyrrolidin-3-ylidene)prop-1-enyl]-dimethylazanium |
| SMILES | C[NH+](C)/C=C/C=C1\CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H16N2O2/c1-16(2)10-6-7-12-11-14(18)17(15(12)19)13-8-4-3-5-9-13/h3-10H,11H2,1-2H3/p+1/b10-6+,12-7+ |
| InChIKey | SNADLNWTQWDSFM-QXZILWSFSA-O |
| XLogP | 0.53 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|