About N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide
N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide (PubChem CID 2168339) has the molecular formula C6H8F4N2O2
and a molecular weight of 216.13 g/mol. Its IUPAC name is N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide |
| PubChem CID | 2168339 |
| Molecular Formula | C6H8F4N2O2 |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide |
| SMILES | O=C(NCCNC(=O)C(F)F)C(F)F |
| InChI | InChI=1S/C6H8F4N2O2/c7-3(8)5(13)11-1-2-12-6(14)4(9)10/h3-4H,1-2H2,(H,11,13)(H,12,14) |
| InChIKey | VGCUSSNRONFNFZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide?
The IUPAC name of N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide (CID 2168339) is N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide.
What is the SMILES notation for N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide?
The canonical SMILES for N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide is O=C(NCCNC(=O)C(F)F)C(F)F.
What is the InChIKey of N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide?
The InChIKey is VGCUSSNRONFNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F4N2O2/c7-3(8)5(13)11-1-2-12-6(14)4(9)10/h3-4H,1-2H2,(H,11,13)(H,12,14).
What are the key properties of N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide?
N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide has a molecular weight of 216.13 g/mol, XLogP of -0.25, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,2-difluoroacetyl)amino]ethyl]-2,2-difluoroacetamide is sourced from PubChem (CID 2168339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).