About 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one
4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one (PubChem CID 2168422) has the molecular formula C20H22Cl2N2O2
and a molecular weight of 393.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one |
| PubChem CID | 2168422 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c21-16-8-9-19(18(22)15-16)26-14-4-7-20(25)24-12-10-23(11-13-24)17-5-2-1-3-6-17/h1-3,5-6,8-9,15H,4,7,10-14H2 |
| InChIKey | IVQSWGRXIWBWGA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one?
The IUPAC name of 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one (CID 2168422) is 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one.
What is the SMILES notation for 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one?
The canonical SMILES for 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one is O=C(CCCOc1ccc(Cl)cc1Cl)N1CCN(c2ccccc2)CC1.
What is the InChIKey of 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one?
The InChIKey is IVQSWGRXIWBWGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N2O2/c21-16-8-9-19(18(22)15-16)26-14-4-7-20(25)24-12-10-23(11-13-24)17-5-2-1-3-6-17/h1-3,5-6,8-9,15H,4,7,10-14H2.
What are the key properties of 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one?
4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one has a molecular weight of 393.31 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenoxy)-1-(4-phenylpiperazin-1-yl)butan-1-one is sourced from PubChem (CID 2168422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).