About ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate
ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate (PubChem CID 2168620) has the molecular formula C22H19F2NO4S
and a molecular weight of 431.46 g/mol. Its IUPAC name is ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate |
| PubChem CID | 2168620 |
| Molecular Formula | C22H19F2NO4S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2c(F)cccc2F)sc(C)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H19F2NO4S/c1-4-29-22(27)19-17(13-8-10-14(28-3)11-9-13)12(2)30-21(19)25-20(26)18-15(23)6-5-7-16(18)24/h5-11H,4H2,1-3H3,(H,25,26) |
| InChIKey | KCEGMUPEHNKVDV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate?
The IUPAC name of ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate (CID 2168620) is ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate.
What is the SMILES notation for ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate?
The canonical SMILES for ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate is CCOC(=O)c1c(NC(=O)c2c(F)cccc2F)sc(C)c1-c1ccc(OC)cc1.
What is the InChIKey of ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate?
The InChIKey is KCEGMUPEHNKVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2NO4S/c1-4-29-22(27)19-17(13-8-10-14(28-3)11-9-13)12(2)30-21(19)25-20(26)18-15(23)6-5-7-16(18)24/h5-11H,4H2,1-3H3,(H,25,26).
What are the key properties of ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate?
ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate has a molecular weight of 431.46 g/mol, XLogP of 5.44, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2,6-difluorobenzoyl)amino]-4-(4-methoxyphenyl)-5-methylthiophene-3-carboxylate is sourced from PubChem (CID 2168620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).