About N,N-dibutyl-3,3-dimethylbutanamide
N,N-dibutyl-3,3-dimethylbutanamide (PubChem CID 2169365) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is N,N-dibutyl-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N,N-dibutyl-3,3-dimethylbutanamide |
| PubChem CID | 2169365 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N,N-dibutyl-3,3-dimethylbutanamide |
| SMILES | CCCCN(CCCC)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C14H29NO/c1-6-8-10-15(11-9-7-2)13(16)12-14(3,4)5/h6-12H2,1-5H3 |
| InChIKey | VKKCXSJCZAHXIY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dibutyl-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-3,3-dimethylbutanamide?
The IUPAC name of N,N-dibutyl-3,3-dimethylbutanamide (CID 2169365) is N,N-dibutyl-3,3-dimethylbutanamide.
What is the SMILES notation for N,N-dibutyl-3,3-dimethylbutanamide?
The canonical SMILES for N,N-dibutyl-3,3-dimethylbutanamide is CCCCN(CCCC)C(=O)CC(C)(C)C.
What is the InChIKey of N,N-dibutyl-3,3-dimethylbutanamide?
The InChIKey is VKKCXSJCZAHXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-6-8-10-15(11-9-7-2)13(16)12-14(3,4)5/h6-12H2,1-5H3.
What are the key properties of N,N-dibutyl-3,3-dimethylbutanamide?
N,N-dibutyl-3,3-dimethylbutanamide has a molecular weight of 227.39 g/mol, XLogP of 3.85, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-3,3-dimethylbutanamide is sourced from PubChem (CID 2169365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).