C21H14F5NO — CID 2169584
N,N-dibenzyl-2,3,4,5,6-pentafluorobenzamide (PubChem CID 2169584) has the molecular formula C21H14F5NO and a molecular weight of 391.34 g/mol. Its IUPAC name is N,N-dibenzyl-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N,N-dibenzyl-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 2169584 |
| Molecular Formula | C21H14F5NO |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N,N-dibenzyl-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H14F5NO/c22-16-15(17(23)19(25)20(26)18(16)24)21(28)27(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | VNDQUAZXFQWVNT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|