C14H15NOS — CID 2169712
N-(3-phenylpropyl)thiophene-2-carboxamide (PubChem CID 2169712) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is N-(3-phenylpropyl)thiophene-2-carboxamide.
| Compound Name | N-(3-phenylpropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2169712 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-(3-phenylpropyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C14H15NOS/c16-14(13-9-5-11-17-13)15-10-4-8-12-6-2-1-3-7-12/h1-3,5-7,9,11H,4,8,10H2,(H,15,16) |
| InChIKey | KZYPKZIQOMGIAS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|