About N-(3-acetylphenyl)-3,4-dimethoxybenzamide
N-(3-acetylphenyl)-3,4-dimethoxybenzamide (PubChem CID 2171051) has the molecular formula C17H17NO4
and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(3-acetylphenyl)-3,4-dimethoxybenzamide |
| PubChem CID | 2171051 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-(3-acetylphenyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C(C)=O)c2)cc1OC |
| InChI | InChI=1S/C17H17NO4/c1-11(19)12-5-4-6-14(9-12)18-17(20)13-7-8-15(21-2)16(10-13)22-3/h4-10H,1-3H3,(H,18,20) |
| InChIKey | VCNDIQAPSXXUTG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-acetylphenyl)-3,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetylphenyl)-3,4-dimethoxybenzamide?
The IUPAC name of N-(3-acetylphenyl)-3,4-dimethoxybenzamide (CID 2171051) is N-(3-acetylphenyl)-3,4-dimethoxybenzamide.
What is the SMILES notation for N-(3-acetylphenyl)-3,4-dimethoxybenzamide?
The canonical SMILES for N-(3-acetylphenyl)-3,4-dimethoxybenzamide is COc1ccc(C(=O)Nc2cccc(C(C)=O)c2)cc1OC.
What is the InChIKey of N-(3-acetylphenyl)-3,4-dimethoxybenzamide?
The InChIKey is VCNDIQAPSXXUTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4/c1-11(19)12-5-4-6-14(9-12)18-17(20)13-7-8-15(21-2)16(10-13)22-3/h4-10H,1-3H3,(H,18,20).
What are the key properties of N-(3-acetylphenyl)-3,4-dimethoxybenzamide?
N-(3-acetylphenyl)-3,4-dimethoxybenzamide has a molecular weight of 299.33 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetylphenyl)-3,4-dimethoxybenzamide is sourced from PubChem (CID 2171051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).