About N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide
N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide (PubChem CID 2171068) has the molecular formula C14H9N3O7
and a molecular weight of 331.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide |
| PubChem CID | 2171068 |
| Molecular Formula | C14H9N3O7 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9N3O7/c18-14(15-8-1-4-12-13(5-8)24-7-23-12)10-3-2-9(16(19)20)6-11(10)17(21)22/h1-6H,7H2,(H,15,18) |
| InChIKey | DFRTUMLTBXPLQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide (CID 2171068) is N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide is O=C(Nc1ccc2c(c1)OCO2)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide?
The InChIKey is DFRTUMLTBXPLQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O7/c18-14(15-8-1-4-12-13(5-8)24-7-23-12)10-3-2-9(16(19)20)6-11(10)17(21)22/h1-6H,7H2,(H,15,18).
What are the key properties of N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide?
N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide has a molecular weight of 331.24 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-2,4-dinitrobenzamide is sourced from PubChem (CID 2171068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).