C16H26N3O2S+ — CID 2171097
N-(2-methoxyethyl)-4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide (PubChem CID 2171097) has the molecular formula C16H26N3O2S+ and a molecular weight of 324.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(2-methoxyethyl)-4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 2171097 |
| Molecular Formula | C16H26N3O2S+ |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-(2-methoxyethyl)-4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide |
| SMILES | COCCNC(=S)N1CC[NH+](Cc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C16H25N3O2S/c1-20-11-6-17-16(22)19-9-7-18(8-10-19)13-14-4-3-5-15(12-14)21-2/h3-5,12H,6-11,13H2,1-2H3,(H,17,22)/p+1 |
| InChIKey | NVDAQEMSJHUARG-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 38.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|