About 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea
1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea (PubChem CID 2171119) has the molecular formula C16H17FN2S2
and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(4-methylphenyl)sulfanylethyl]thiourea.
Molecular Properties
| Compound Name | 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea |
| PubChem CID | 2171119 |
| Molecular Formula | C16H17FN2S2 |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(4-methylphenyl)sulfanylethyl]thiourea |
| SMILES | CC1=CC=C(C=C1)SCCNC(=S)NC2=CC=C(C=C2)F |
| InChI | InChI=1S/C16H17FN2S2/c1-12-2-8-15(9-3-12)21-11-10-18-16(20)19-14-6-4-13(17)5-7-14/h2-9H,10-11H2,1H3,(H2,18,19,20) |
| InChIKey | YXFLVHOMNLXUCF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | 311 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea?
The IUPAC name of 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea (CID 2171119) is 1-(4-fluorophenyl)-3-[2-(4-methylphenyl)sulfanylethyl]thiourea.
What is the SMILES notation for 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea?
The canonical SMILES for 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea is CC1=CC=C(C=C1)SCCNC(=S)NC2=CC=C(C=C2)F.
What is the InChIKey of 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea?
The InChIKey is YXFLVHOMNLXUCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2S2/c1-12-2-8-15(9-3-12)21-11-10-18-16(20)19-14-6-4-13(17)5-7-14/h2-9H,10-11H2,1H3,(H2,18,19,20).
What are the key properties of 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea?
1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea has a molecular weight of 320.50 g/mol, XLogP of 4.20, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-Fluorophenyl)-3-{2-[(4-methylphenyl)sulfanyl]ethyl}thiourea is sourced from PubChem (CID 2171119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).