About [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate
[2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 2171175) has the molecular formula C21H14N2O8
and a molecular weight of 422.35 g/mol. Its IUPAC name is [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate.
Molecular Properties
| Compound Name | [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| PubChem CID | 2171175 |
| Molecular Formula | C21H14N2O8 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)C(=O)c2ccccc21)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H14N2O8/c24-16(9-22-15-8-4-3-7-14(15)18(26)21(22)29)30-10-17(25)31-11-23-19(27)12-5-1-2-6-13(12)20(23)28/h1-8H,9-11H2 |
| InChIKey | AJJAFCPXBXTZLX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate?
The IUPAC name of [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate (CID 2171175) is [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate.
What is the SMILES notation for [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate?
The canonical SMILES for [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate is O=C(COC(=O)CN1C(=O)C(=O)c2ccccc21)OCN1C(=O)c2ccccc2C1=O.
What is the InChIKey of [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate?
The InChIKey is AJJAFCPXBXTZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N2O8/c24-16(9-22-15-8-4-3-7-14(15)18(26)21(22)29)30-10-17(25)31-11-23-19(27)12-5-1-2-6-13(12)20(23)28/h1-8H,9-11H2.
What are the key properties of [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate?
[2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate has a molecular weight of 422.35 g/mol, XLogP of 0.56, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,3-dioxoisoindol-2-yl)methoxy]-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate is sourced from PubChem (CID 2171175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).