C20H17N5O2S — CID 2171462
2-[6-amino-1-(3-methylphenyl)-4-oxopyrimidin-2-yl]sulfanyl-N-(2-cyanophenyl)acetamide (PubChem CID 2171462) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is 2-[6-amino-1-(3-methylphenyl)-4-oxopyrimidin-2-yl]sulfanyl-N-(2-cyanophenyl)acetamide.
| Compound Name | 2-[6-amino-1-(3-methylphenyl)-4-oxopyrimidin-2-yl]sulfanyl-N-(2-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 2171462 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[6-amino-1-(3-methylphenyl)-4-oxopyrimidin-2-yl]sulfanyl-N-(2-cyanophenyl)acetamide |
| SMILES | Cc1cccc(-n2c(N)cc(=O)nc2SCC(=O)Nc2ccccc2C#N)c1 |
| InChI | InChI=1S/C20H17N5O2S/c1-13-5-4-7-15(9-13)25-17(22)10-18(26)24-20(25)28-12-19(27)23-16-8-3-2-6-14(16)11-21/h2-10H,12,22H2,1H3,(H,23,27) |
| InChIKey | ZORPLZBUQTZJEG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |