C23H21F2NO4 — CID 2171479
diethyl 1,4-bis(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 2171479) has the molecular formula C23H21F2NO4 and a molecular weight of 413.42 g/mol. Its IUPAC name is diethyl 1,4-bis(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1,4-bis(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 2171479 |
| Molecular Formula | C23H21F2NO4 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | diethyl 1,4-bis(4-fluorophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(c2ccc(F)cc2)C=C(C(=O)OCC)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21F2NO4/c1-3-29-22(27)19-13-26(18-11-9-17(25)10-12-18)14-20(23(28)30-4-2)21(19)15-5-7-16(24)8-6-15/h5-14,21H,3-4H2,1-2H3 |
| InChIKey | PEPJBKKLPOJLGL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |