About 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide
2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide (PubChem CID 2172058) has the molecular formula C11H8ClN3O5S2
and a molecular weight of 361.79 g/mol. Its IUPAC name is 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 2172058 |
| Molecular Formula | C11H8ClN3O5S2 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CCl)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C11H8ClN3O5S2/c12-5-9(16)14-11-13-6-10(21-11)22(19,20)8-3-1-7(2-4-8)15(17)18/h1-4,6H,5H2,(H,13,14,16) |
| InChIKey | MSWLLKPVXVYPBJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide?
The IUPAC name of 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide (CID 2172058) is 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide is O=C(CCl)Nc1ncc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1.
What is the InChIKey of 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide?
The InChIKey is MSWLLKPVXVYPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3O5S2/c12-5-9(16)14-11-13-6-10(21-11)22(19,20)8-3-1-7(2-4-8)15(17)18/h1-4,6H,5H2,(H,13,14,16).
What are the key properties of 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide?
2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide has a molecular weight of 361.79 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 2172058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).