About 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile
2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 2172514) has the molecular formula C13H12N4S2
and a molecular weight of 288.40 g/mol. Its IUPAC name is 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile |
| PubChem CID | 2172514 |
| Molecular Formula | C13H12N4S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | CCc1ccc(C2C(C#N)=C(N)SC(N)=C2C#N)s1 |
| InChI | InChI=1S/C13H12N4S2/c1-2-7-3-4-10(18-7)11-8(5-14)12(16)19-13(17)9(11)6-15/h3-4,11H,2,16-17H2,1H3 |
| InChIKey | QXDXZQAGNCQLAG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile?
The IUPAC name of 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile (CID 2172514) is 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile.
What is the SMILES notation for 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile?
The canonical SMILES for 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile is CCc1ccc(C2C(C#N)=C(N)SC(N)=C2C#N)s1.
What is the InChIKey of 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile?
The InChIKey is QXDXZQAGNCQLAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4S2/c1-2-7-3-4-10(18-7)11-8(5-14)12(16)19-13(17)9(11)6-15/h3-4,11H,2,16-17H2,1H3.
What are the key properties of 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile?
2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile has a molecular weight of 288.40 g/mol, XLogP of 2.53, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diamino-4-(5-ethylthiophen-2-yl)-4H-thiopyran-3,5-dicarbonitrile is sourced from PubChem (CID 2172514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).