About N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide
N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide (PubChem CID 2173045) has the molecular formula C18H19ClN2O3
and a molecular weight of 346.81 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide.
Molecular Properties
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide |
| PubChem CID | 2173045 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCCOc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-12-3-8-16(13(2)11-12)21-18(23)17(22)20-9-10-24-15-6-4-14(19)5-7-15/h3-8,11H,9-10H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | SVWJCKBZAAIRLH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide?
The IUPAC name of N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide (CID 2173045) is N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide.
What is the SMILES notation for N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide?
The canonical SMILES for N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide is Cc1ccc(NC(=O)C(=O)NCCOc2ccc(Cl)cc2)c(C)c1.
What is the InChIKey of N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide?
The InChIKey is SVWJCKBZAAIRLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O3/c1-12-3-8-16(13(2)11-12)21-18(23)17(22)20-9-10-24-15-6-4-14(19)5-7-15/h3-8,11H,9-10H2,1-2H3,(H,20,22)(H,21,23).
What are the key properties of N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide?
N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide has a molecular weight of 346.81 g/mol, XLogP of 3.09, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-chlorophenoxy)ethyl]-N'-(2,4-dimethylphenyl)oxamide is sourced from PubChem (CID 2173045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).