C25H17NO2S — CID 2173285
(12R)-12-(5-methylthiophen-2-yl)-9-oxa-13-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,15,17,19,21-nonaen-10-one (PubChem CID 2173285) has the molecular formula C25H17NO2S and a molecular weight of 395.48 g/mol. Its IUPAC name is (12R)-12-(5-methylthiophen-2-yl)-9-oxa-13-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,15,17,19,21-nonaen-10-one.
| Compound Name | (12R)-12-(5-methylthiophen-2-yl)-9-oxa-13-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,15,17,19,21-nonaen-10-one |
|---|---|
| PubChem CID | 2173285 |
| Molecular Formula | C25H17NO2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (12R)-12-(5-methylthiophen-2-yl)-9-oxa-13-azapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,15,17,19,21-nonaen-10-one |
| SMILES | Cc1ccc([C@@H]2Nc3ccc4ccccc4c3-c3c2c(=O)oc2ccccc32)s1 |
| InChI | InChI=1S/C25H17NO2S/c1-14-10-13-20(29-14)24-23-22(17-8-4-5-9-19(17)28-25(23)27)21-16-7-3-2-6-15(16)11-12-18(21)26-24/h2-13,24,26H,1H3/t24-/m0/s1 |
| InChIKey | RRWUMKFGTJQKBA-DEOSSOPVSA-N |
| XLogP | 6.50 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|