C19H16Br2N2O4 — CID 2173660
(4Z)-4-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(3,4-dimethylphenyl)pyrazolidine-3,5-dione (PubChem CID 2173660) has the molecular formula C19H16Br2N2O4 and a molecular weight of 496.16 g/mol. Its IUPAC name is (4Z)-4-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(3,4-dimethylphenyl)pyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(3,4-dimethylphenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 2173660 |
| Molecular Formula | C19H16Br2N2O4 |
| Molecular Weight | 496.16 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | (4Z)-4-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(3,4-dimethylphenyl)pyrazolidine-3,5-dione |
| SMILES | COc1cc(/C=C2/C(=O)NN(c3ccc(C)c(C)c3)C2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C19H16Br2N2O4/c1-9-4-5-12(6-10(9)2)23-19(26)13(18(25)22-23)7-11-8-14(27-3)17(24)16(21)15(11)20/h4-8,24H,1-3H3,(H,22,25)/b13-7- |
| InChIKey | ARNZNERPQYSFSL-QPEQYQDCSA-N |
| XLogP | 4.00 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.16 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|