C16H16N2O2 — CID 2174485
N-[(2-methylphenyl)methyl]-N'-phenyloxamide (PubChem CID 2174485) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-N'-phenyloxamide.
| Compound Name | N-[(2-methylphenyl)methyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 2174485 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-N'-phenyloxamide |
| SMILES | Cc1ccccc1CNC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c1-12-7-5-6-8-13(12)11-17-15(19)16(20)18-14-9-3-2-4-10-14/h2-10H,11H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | UPBFNMXRGVVKNB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|