C12H8F3NO2 — CID 2174852
1-(1-acetylindol-3-yl)-2,2,2-trifluoroethanone (PubChem CID 2174852) has the molecular formula C12H8F3NO2 and a molecular weight of 255.19 g/mol. Its IUPAC name is 1-(1-acetylindol-3-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1-acetylindol-3-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 2174852 |
| Molecular Formula | C12H8F3NO2 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 1-(1-acetylindol-3-yl)-2,2,2-trifluoroethanone |
| SMILES | CC(=O)n1cc(C(=O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C12H8F3NO2/c1-7(17)16-6-9(11(18)12(13,14)15)8-4-2-3-5-10(8)16/h2-6H,1H3 |
| InChIKey | QSYDYYVFVAIQIW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |