About 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea
1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 2175982) has the molecular formula C12H15F3N2O2S
and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea.
Molecular Properties
| Compound Name | 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
| PubChem CID | 2175982 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | COC(CNC(=S)Nc1cccc(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C12H15F3N2O2S/c1-18-10(19-2)7-16-11(20)17-9-5-3-4-8(6-9)12(13,14)15/h3-6,10H,7H2,1-2H3,(H2,16,17,20) |
| InChIKey | QDJWHMPNLXKVMS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea?
The IUPAC name of 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea (CID 2175982) is 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea.
What is the SMILES notation for 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea?
The canonical SMILES for 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea is COC(CNC(=S)Nc1cccc(C(F)(F)F)c1)OC.
What is the InChIKey of 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea?
The InChIKey is QDJWHMPNLXKVMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O2S/c1-18-10(19-2)7-16-11(20)17-9-5-3-4-8(6-9)12(13,14)15/h3-6,10H,7H2,1-2H3,(H2,16,17,20).
What are the key properties of 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea?
1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea has a molecular weight of 308.33 g/mol, XLogP of 2.61, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethyl)phenyl]thiourea is sourced from PubChem (CID 2175982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).