C24H28N2O5 — CID 2176129
N-[2-(3,4-diethoxyphenyl)ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 2176129) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 2176129 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | CCOc1ccc(CCNC(=O)CCCN2C(=O)c3ccccc3C2=O)cc1OCC |
| InChI | InChI=1S/C24H28N2O5/c1-3-30-20-12-11-17(16-21(20)31-4-2)13-14-25-22(27)10-7-15-26-23(28)18-8-5-6-9-19(18)24(26)29/h5-6,8-9,11-12,16H,3-4,7,10,13-15H2,1-2H3,(H,25,27) |
| InChIKey | FPBACZXPMOEEHU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|