C16H11N2O6S2- — CID 2176320
4-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-nitrophenolate (PubChem CID 2176320) has the molecular formula C16H11N2O6S2- and a molecular weight of 391.41 g/mol. Its IUPAC name is 4-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 2176320 |
| Molecular Formula | C16H11N2O6S2- |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 4-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=C2/SC(=S)N(Cc3ccco3)C2=O)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C16H12N2O6S2/c1-23-12-6-9(5-11(14(12)19)18(21)22)7-13-15(20)17(16(25)26-13)8-10-3-2-4-24-10/h2-7,19H,8H2,1H3/p-1/b13-7+ |
| InChIKey | VECMQEMHYIKJJA-NTUHNPAUSA-M |
| XLogP | 2.67 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|