C18H19N2O4S2- — CID 2176834
4-[(E)-[3-(2-cyclohexylethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenolate (PubChem CID 2176834) has the molecular formula C18H19N2O4S2- and a molecular weight of 391.49 g/mol. Its IUPAC name is 4-[(E)-[3-(2-cyclohexylethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[(E)-[3-(2-cyclohexylethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 2176834 |
| Molecular Formula | C18H19N2O4S2- |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 4-[(E)-[3-(2-cyclohexylethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-nitrophenolate |
| SMILES | O=C1/C(=C\c2ccc([O-])c([N+](=O)[O-])c2)SC(=S)N1CCC1CCCCC1 |
| InChI | InChI=1S/C18H20N2O4S2/c21-15-7-6-13(10-14(15)20(23)24)11-16-17(22)19(18(25)26-16)9-8-12-4-2-1-3-5-12/h6-7,10-12,21H,1-5,8-9H2/p-1/b16-11+ |
| InChIKey | URFFRLHZKVDCGO-LFIBNONCSA-M |
| XLogP | 3.84 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|