C22H21N3O3 — CID 2177060
(Z)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-N,N-dimethylprop-2-enamide (PubChem CID 2177060) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is (Z)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | (Z)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 2177060 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (Z)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C\c1cn(-c2ccccc2)nc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H21N3O3/c1-24(2)21(26)11-9-17-15-25(18-6-4-3-5-7-18)23-22(17)16-8-10-19-20(14-16)28-13-12-27-19/h3-11,14-15H,12-13H2,1-2H3/b11-9- |
| InChIKey | QHQSILJOWJUZGR-LUAWRHEFSA-N |
| XLogP | 3.41 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|