C13H22OSi — CID 21771016
2-[(2S,3S)-2-butyl-3-ethenyloxiran-2-yl]ethynyl-trimethylsilane (PubChem CID 21771016) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is 2-[(2S,3S)-2-butyl-3-ethenyloxiran-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2S,3S)-2-butyl-3-ethenyloxiran-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 21771016 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[(2S,3S)-2-butyl-3-ethenyloxiran-2-yl]ethynyl-trimethylsilane |
| SMILES | CCCC[C@@]1([C@@H](O1)C=C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi/c1-6-8-9-13(12(7-2)14-13)10-11-15(3,4)5/h7,12H,2,6,8-9H2,1,3-5H3/t12-,13-/m0/s1 |
| InChIKey | ZLQNJVQETVRUKH-STQMWFEESA-N |
| XLogP | — |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | 301 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|