About 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione
6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione (PubChem CID 2177103) has the molecular formula C20H12BrNO2
and a molecular weight of 378.23 g/mol. Its IUPAC name is 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione.
Molecular Properties
| Compound Name | 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione |
| PubChem CID | 2177103 |
| Molecular Formula | C20H12BrNO2 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione |
| SMILES | O=c1c2ccccc2c2ccccc2c(=O)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H12BrNO2/c21-13-9-11-14(12-10-13)22-19(23)17-7-3-1-5-15(17)16-6-2-4-8-18(16)20(22)24/h1-12H |
| InChIKey | LQDODMQBDOSJKQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione?
The IUPAC name of 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione (CID 2177103) is 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione.
What is the SMILES notation for 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione?
The canonical SMILES for 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione is O=c1c2ccccc2c2ccccc2c(=O)n1-c1ccc(Br)cc1.
What is the InChIKey of 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione?
The InChIKey is LQDODMQBDOSJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12BrNO2/c21-13-9-11-14(12-10-13)22-19(23)17-7-3-1-5-15(17)16-6-2-4-8-18(16)20(22)24/h1-12H.
What are the key properties of 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione?
6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione has a molecular weight of 378.23 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-bromophenyl)benzo[d][2]benzazepine-5,7-dione is sourced from PubChem (CID 2177103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).