C15H11N3O4 — CID 2177195
5-[(1-acetylindol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 2177195) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 5-[(1-acetylindol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(1-acetylindol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2177195 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-[(1-acetylindol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)n1cc(C=C2C(=O)NC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H11N3O4/c1-8(19)18-7-9(10-4-2-3-5-12(10)18)6-11-13(20)16-15(22)17-14(11)21/h2-7H,1H3,(H2,16,17,20,21,22) |
| InChIKey | AFWXGUGBULJJBI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|