C21H17NO3 — CID 2179635
methyl (Z)-2-(naphthalene-1-carbonylamino)-3-phenylprop-2-enoate (PubChem CID 2179635) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl (Z)-2-(naphthalene-1-carbonylamino)-3-phenylprop-2-enoate.
| Compound Name | methyl (Z)-2-(naphthalene-1-carbonylamino)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 2179635 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl (Z)-2-(naphthalene-1-carbonylamino)-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccccc1)NC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H17NO3/c1-25-21(24)19(14-15-8-3-2-4-9-15)22-20(23)18-13-7-11-16-10-5-6-12-17(16)18/h2-14H,1H3,(H,22,23)/b19-14- |
| InChIKey | ROKGJIQTMIOJFY-RGEXLXHISA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|