C12H13N5O3 — CID 2179826
3-[3-(2-cyanoethyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propanenitrile (PubChem CID 2179826) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 3-[3-(2-cyanoethyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propanenitrile.
| Compound Name | 3-[3-(2-cyanoethyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propanenitrile |
|---|---|
| PubChem CID | 2179826 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3-[3-(2-cyanoethyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propanenitrile |
| SMILES | C=CCn1c(=O)n(CCC#N)c(=O)n(CCC#N)c1=O |
| InChI | InChI=1S/C12H13N5O3/c1-2-7-15-10(18)16(8-3-5-13)12(20)17(11(15)19)9-4-6-14/h2H,1,3-4,7-9H2 |
| InChIKey | ZYXSWFOMIGSKSD-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 113.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|