About 3-piperidin-2-ylpyridine
3-piperidin-2-ylpyridine (PubChem CID 2181) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-piperidin-2-ylpyridine.
Molecular Properties
| Compound Name | 3-piperidin-2-ylpyridine |
| PubChem CID | 2181 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-piperidin-2-ylpyridine |
| SMILES | c1cncc(C2CCCCN2)c1 |
| InChI | InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
| InChIKey | MTXSIJUGVMTTMU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-piperidin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-2-ylpyridine?
The IUPAC name of 3-piperidin-2-ylpyridine (CID 2181) is 3-piperidin-2-ylpyridine.
What is the SMILES notation for 3-piperidin-2-ylpyridine?
The canonical SMILES for 3-piperidin-2-ylpyridine is c1cncc(C2CCCCN2)c1.
What is the InChIKey of 3-piperidin-2-ylpyridine?
The InChIKey is MTXSIJUGVMTTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2.
What are the key properties of 3-piperidin-2-ylpyridine?
3-piperidin-2-ylpyridine has a molecular weight of 162.24 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-2-ylpyridine is sourced from PubChem (CID 2181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).