About (+-)-Anabasine
(+-)-Anabasine (PubChem CID 2181) has the molecular formula C10H14N2
and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-piperidin-2-ylpyridine.
Molecular Properties
| Compound Name | (+-)-Anabasine |
| PubChem CID | 2181 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-piperidin-2-ylpyridine |
| SMILES | C1CCNC(C1)C2=CN=CC=C2 |
| InChI | InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
| InChIKey | MTXSIJUGVMTTMU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 136 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (+-)-Anabasine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (+-)-Anabasine?
The IUPAC name of (+-)-Anabasine (CID 2181) is 3-piperidin-2-ylpyridine.
What is the SMILES notation for (+-)-Anabasine?
The canonical SMILES for (+-)-Anabasine is C1CCNC(C1)C2=CN=CC=C2.
What is the InChIKey of (+-)-Anabasine?
The InChIKey is MTXSIJUGVMTTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2.
What are the key properties of (+-)-Anabasine?
(+-)-Anabasine has a molecular weight of 162.23 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (+-)-Anabasine is sourced from PubChem (CID 2181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).