C17H29NO — CID 2182203
N,N-dimethyl-4-[4-(2-methylbutan-2-yl)phenoxy]butan-1-amine (PubChem CID 2182203) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[4-(2-methylbutan-2-yl)phenoxy]butan-1-amine.
| Compound Name | N,N-dimethyl-4-[4-(2-methylbutan-2-yl)phenoxy]butan-1-amine |
|---|---|
| PubChem CID | 2182203 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N,N-dimethyl-4-[4-(2-methylbutan-2-yl)phenoxy]butan-1-amine |
| SMILES | CCC(C)(C)c1ccc(OCCCCN(C)C)cc1 |
| InChI | InChI=1S/C17H29NO/c1-6-17(2,3)15-9-11-16(12-10-15)19-14-8-7-13-18(4)5/h9-12H,6-8,13-14H2,1-5H3 |
| InChIKey | BVXSRPSLBIETJS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|