About 2-phenyl-1,3-dithiolane
2-phenyl-1,3-dithiolane (PubChem CID 21830) has the molecular formula C9H10S2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-phenyl-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-phenyl-1,3-dithiolane |
| PubChem CID | 21830 |
| Molecular Formula | C9H10S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 2-phenyl-1,3-dithiolane |
| SMILES | c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C9H10S2/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-5,9H,6-7H2 |
| InChIKey | RKBPDPLCHXWHRQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-dithiolane?
The IUPAC name of 2-phenyl-1,3-dithiolane (CID 21830) is 2-phenyl-1,3-dithiolane.
What is the SMILES notation for 2-phenyl-1,3-dithiolane?
The canonical SMILES for 2-phenyl-1,3-dithiolane is c1ccc(C2SCCS2)cc1.
What is the InChIKey of 2-phenyl-1,3-dithiolane?
The InChIKey is RKBPDPLCHXWHRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10S2/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-5,9H,6-7H2.
What are the key properties of 2-phenyl-1,3-dithiolane?
2-phenyl-1,3-dithiolane has a molecular weight of 182.31 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-dithiolane is sourced from PubChem (CID 21830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).