About [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate
[[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate (PubChem CID 2184676) has the molecular formula C17H16Cl2N2O2
and a molecular weight of 351.23 g/mol. Its IUPAC name is [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate.
Molecular Properties
| Compound Name | [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate |
| PubChem CID | 2184676 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)ON=C(N)Cc2ccc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C17H16Cl2N2O2/c1-10-3-5-13(7-11(10)2)17(22)23-21-16(20)9-12-4-6-14(18)15(19)8-12/h3-8H,9H2,1-2H3,(H2,20,21) |
| InChIKey | ADKHASUKWMBHGS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate?
The IUPAC name of [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate (CID 2184676) is [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate.
What is the SMILES notation for [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate?
The canonical SMILES for [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate is Cc1ccc(C(=O)ON=C(N)Cc2ccc(Cl)c(Cl)c2)cc1C.
What is the InChIKey of [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate?
The InChIKey is ADKHASUKWMBHGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2N2O2/c1-10-3-5-13(7-11(10)2)17(22)23-21-16(20)9-12-4-6-14(18)15(19)8-12/h3-8H,9H2,1-2H3,(H2,20,21).
What are the key properties of [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate?
[[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate has a molecular weight of 351.23 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-amino-2-(3,4-dichlorophenyl)ethylidene]amino] 3,4-dimethylbenzoate is sourced from PubChem (CID 2184676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).