About 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione
2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 21850) has the molecular formula C11H19N5O3
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 21850 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | CC(C)(N)CO.Cn1c(=O)c2[nH]cnc2n(C)c1=O |
| InChI | InChI=1S/C7H8N4O2.C4H11NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-4(2,5)3-6/h3H,1-2H3,(H,8,9);6H,3,5H2,1-2H3 |
| InChIKey | SEIRRUDMPNNSCY-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione (CID 21850) is 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione is CC(C)(N)CO.Cn1c(=O)c2[nH]cnc2n(C)c1=O.
What is the InChIKey of 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is SEIRRUDMPNNSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2.C4H11NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-4(2,5)3-6/h3H,1-2H3,(H,8,9);6H,3,5H2,1-2H3.
What are the key properties of 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione?
2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 269.30 g/mol, XLogP of -1.32, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methylpropan-1-ol;1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 21850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).