C13H14Cl2N4OS — CID 2185790
2,4-dichloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 2185790) has the molecular formula C13H14Cl2N4OS and a molecular weight of 345.26 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2185790 |
| Molecular Formula | C13H14Cl2N4OS |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2,4-dichloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | CCn1c(CCNC(=O)c2ccc(Cl)cc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C13H14Cl2N4OS/c1-2-19-11(17-18-13(19)21)5-6-16-12(20)9-4-3-8(14)7-10(9)15/h3-4,7H,2,5-6H2,1H3,(H,16,20)(H,18,21) |
| InChIKey | CFVMDKIOKRWZLW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|