C11H20N6O3 — CID 2185926
methyl N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]carbamate (PubChem CID 2185926) has the molecular formula C11H20N6O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 2185926 |
| Molecular Formula | C11H20N6O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | methyl N-[2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]ethyl]carbamate |
| SMILES | COC(=O)NCCOc1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H20N6O3/c1-16(2)8-13-9(17(3)4)15-10(14-8)20-7-6-12-11(18)19-5/h6-7H2,1-5H3,(H,12,18) |
| InChIKey | XONWRNREIQZLCE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|