C14H8N2O5 — CID 2186033
5-[(4-oxochromen-3-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 2186033) has the molecular formula C14H8N2O5 and a molecular weight of 284.23 g/mol. Its IUPAC name is 5-[(4-oxochromen-3-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-oxochromen-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2186033 |
| Molecular Formula | C14H8N2O5 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 5-[(4-oxochromen-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2coc3ccccc3c2=O)C(=O)N1 |
| InChI | InChI=1S/C14H8N2O5/c17-11-7(6-21-10-4-2-1-3-8(10)11)5-9-12(18)15-14(20)16-13(9)19/h1-6H,(H2,15,16,18,19,20) |
| InChIKey | YBKLVWLMXZLCTP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|