About 2,3-dimethoxybenzonitrile
2,3-dimethoxybenzonitrile (PubChem CID 21862) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2,3-dimethoxybenzonitrile.
Molecular Properties
| Compound Name | 2,3-dimethoxybenzonitrile |
| PubChem CID | 21862 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2,3-dimethoxybenzonitrile |
| SMILES | COc1cccc(C#N)c1OC |
| InChI | InChI=1S/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 |
| InChIKey | LBXGBNHUNHWYRM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxybenzonitrile?
The IUPAC name of 2,3-dimethoxybenzonitrile (CID 21862) is 2,3-dimethoxybenzonitrile.
What is the SMILES notation for 2,3-dimethoxybenzonitrile?
The canonical SMILES for 2,3-dimethoxybenzonitrile is COc1cccc(C#N)c1OC.
What is the InChIKey of 2,3-dimethoxybenzonitrile?
The InChIKey is LBXGBNHUNHWYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3.
What are the key properties of 2,3-dimethoxybenzonitrile?
2,3-dimethoxybenzonitrile has a molecular weight of 163.18 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxybenzonitrile is sourced from PubChem (CID 21862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).