About Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate
Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate (PubChem CID 21862973) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is pentyl 2-hydroxypent-4-enoate.
Molecular Properties
| Compound Name | Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate |
| PubChem CID | 21862973 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | pentyl 2-hydroxypent-4-enoate |
| SMILES | CCCCCOC(=O)C(CC=C)O |
| InChI | InChI=1S/C10H18O3/c1-3-5-6-8-13-10(12)9(11)7-4-2/h4,9,11H,2-3,5-8H2,1H3 |
| InChIKey | JPNCLVHJEKDQNK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | 154 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate?
The IUPAC name of Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate (CID 21862973) is pentyl 2-hydroxypent-4-enoate.
What is the SMILES notation for Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate?
The canonical SMILES for Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate is CCCCCOC(=O)C(CC=C)O.
What is the InChIKey of Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate?
The InChIKey is JPNCLVHJEKDQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-3-5-6-8-13-10(12)9(11)7-4-2/h4,9,11H,2-3,5-8H2,1H3.
What are the key properties of Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate?
Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate has a molecular weight of 186.25 g/mol, XLogP of 2.40, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Prop-2-EN-1-YL 2-(3-methylbutoxy)acetate is sourced from PubChem (CID 21862973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).