C17H18N2O2S — CID 2186534
prop-2-enyl (5R,6R)-4-methylidene-6-[(E)-2-phenylethenyl]-2-sulfanylidene-1,3-diazinane-5-carboxylate (PubChem CID 2186534) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is prop-2-enyl (5R,6R)-4-methylidene-6-[(E)-2-phenylethenyl]-2-sulfanylidene-1,3-diazinane-5-carboxylate.
| Compound Name | prop-2-enyl (5R,6R)-4-methylidene-6-[(E)-2-phenylethenyl]-2-sulfanylidene-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2186534 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | prop-2-enyl (5R,6R)-4-methylidene-6-[(E)-2-phenylethenyl]-2-sulfanylidene-1,3-diazinane-5-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1C(=C)NC(=S)N[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-3-11-21-16(20)15-12(2)18-17(22)19-14(15)10-9-13-7-5-4-6-8-13/h3-10,14-15H,1-2,11H2,(H2,18,19,22)/b10-9+/t14-,15+/m1/s1 |
| InChIKey | CGWYIJZUHQIZCV-SPZIKGKASA-N |
| XLogP | 2.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|