C14H21N3O4S — CID 2186538
N-[2-(benzenesulfonamido)ethyl]-2-morpholin-4-ylacetamide (PubChem CID 2186538) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 2186538 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)NCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21N3O4S/c18-14(12-17-8-10-21-11-9-17)15-6-7-16-22(19,20)13-4-2-1-3-5-13/h1-5,16H,6-12H2,(H,15,18) |
| InChIKey | PIWNUPZBJFRMIY-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|