C15H11FN2O2S — CID 2186734
(5E)-3-[(2-fluorophenyl)methyl]-5-(thiophen-2-ylmethylidene)imidazolidine-2,4-dione (PubChem CID 2186734) has the molecular formula C15H11FN2O2S and a molecular weight of 302.33 g/mol. Its IUPAC name is (5E)-3-[(2-fluorophenyl)methyl]-5-(thiophen-2-ylmethylidene)imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-fluorophenyl)methyl]-5-(thiophen-2-ylmethylidene)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2186734 |
| Molecular Formula | C15H11FN2O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (5E)-3-[(2-fluorophenyl)methyl]-5-(thiophen-2-ylmethylidene)imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cccs2)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C15H11FN2O2S/c16-12-6-2-1-4-10(12)9-18-14(19)13(17-15(18)20)8-11-5-3-7-21-11/h1-8H,9H2,(H,17,20)/b13-8+ |
| InChIKey | BZZCYJLFNYBIEG-MDWZMJQESA-N |
| XLogP | 2.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|