C23H32N2OS — CID 2187048
N-benzyl-N-butyl-1-[(3-methylthiophen-2-yl)methyl]piperidine-4-carboxamide (PubChem CID 2187048) has the molecular formula C23H32N2OS and a molecular weight of 384.59 g/mol. Its IUPAC name is N-benzyl-N-butyl-1-[(3-methylthiophen-2-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-N-butyl-1-[(3-methylthiophen-2-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 2187048 |
| Molecular Formula | C23H32N2OS |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-benzyl-N-butyl-1-[(3-methylthiophen-2-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCCCN(Cc1ccccc1)C(=O)C1CCN(Cc2sccc2C)CC1 |
| InChI | InChI=1S/C23H32N2OS/c1-3-4-13-25(17-20-8-6-5-7-9-20)23(26)21-10-14-24(15-11-21)18-22-19(2)12-16-27-22/h5-9,12,16,21H,3-4,10-11,13-15,17-18H2,1-2H3 |
| InChIKey | FXTZFNUTQSKHMS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |