About (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one
(4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 2188299) has the molecular formula C16H11NO4
and a molecular weight of 281.27 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one |
| PubChem CID | 2188299 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccccc2)/C1=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H11NO4/c18-13-7-6-10(9-14(13)19)8-12-15(17-21-16(12)20)11-4-2-1-3-5-11/h1-9,18-19H/b12-8- |
| InChIKey | APZIDFCOEAKQRJ-WQLSENKSSA-N |
| XLogP | 2.44 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The IUPAC name of (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one (CID 2188299) is (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one.
What is the SMILES notation for (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The canonical SMILES for (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one is O=C1ON=C(c2ccccc2)/C1=C/c1ccc(O)c(O)c1.
What is the InChIKey of (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one?
The InChIKey is APZIDFCOEAKQRJ-WQLSENKSSA-N. The full InChI is InChI=1S/C16H11NO4/c18-13-7-6-10(9-14(13)19)8-12-15(17-21-16(12)20)11-4-2-1-3-5-11/h1-9,18-19H/b12-8-.
What are the key properties of (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one?
(4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one has a molecular weight of 281.27 g/mol, XLogP of 2.44, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one is sourced from PubChem (CID 2188299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).