About (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one
(2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one (PubChem CID 2188500) has the molecular formula C13H13Cl2NO
and a molecular weight of 270.16 g/mol. Its IUPAC name is (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one |
| PubChem CID | 2188500 |
| Molecular Formula | C13H13Cl2NO |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one |
| SMILES | O=C1CCCC/C1=C/Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2NO/c14-10-5-11(15)7-12(6-10)16-8-9-3-1-2-4-13(9)17/h5-8,16H,1-4H2/b9-8- |
| InChIKey | HDWPFADOWXGTCO-HJWRWDBZSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one?
The IUPAC name of (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one (CID 2188500) is (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one.
What is the SMILES notation for (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one?
The canonical SMILES for (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one is O=C1CCCC/C1=C/Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one?
The InChIKey is HDWPFADOWXGTCO-HJWRWDBZSA-N. The full InChI is InChI=1S/C13H13Cl2NO/c14-10-5-11(15)7-12(6-10)16-8-9-3-1-2-4-13(9)17/h5-8,16H,1-4H2/b9-8-.
What are the key properties of (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one?
(2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one has a molecular weight of 270.16 g/mol, XLogP of 4.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(3,5-dichloroanilino)methylidene]cyclohexan-1-one is sourced from PubChem (CID 2188500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).