C26H21NO3 — CID 2188916
(3aS,7aS)-2-[4-(2-phenylphenoxy)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 2188916) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3aS,7aS)-2-[4-(2-phenylphenoxy)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[4-(2-phenylphenoxy)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2188916 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3aS,7aS)-2-[4-(2-phenylphenoxy)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC=CC[C@@H]2C(=O)N1c1ccc(Oc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21NO3/c28-25-22-11-4-5-12-23(22)26(29)27(25)19-14-16-20(17-15-19)30-24-13-7-6-10-21(24)18-8-2-1-3-9-18/h1-10,13-17,22-23H,11-12H2/t22-,23-/m0/s1 |
| InChIKey | ULGPNVANIRSCBR-GOTSBHOMSA-N |
| XLogP | 5.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|