About 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane
4-(4-methoxyphenyl)-5-methyl-1,3-dioxane (PubChem CID 21890) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane |
| PubChem CID | 21890 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane |
| SMILES | COc1ccc(C2OCOCC2C)cc1 |
| InChI | InChI=1S/C12H16O3/c1-9-7-14-8-15-12(9)10-3-5-11(13-2)6-4-10/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | ZHEZIDHIKDDZLJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane?
The IUPAC name of 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane (CID 21890) is 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane.
What is the SMILES notation for 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane?
The canonical SMILES for 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane is COc1ccc(C2OCOCC2C)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane?
The InChIKey is ZHEZIDHIKDDZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-9-7-14-8-15-12(9)10-3-5-11(13-2)6-4-10/h3-6,9,12H,7-8H2,1-2H3.
What are the key properties of 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane?
4-(4-methoxyphenyl)-5-methyl-1,3-dioxane has a molecular weight of 208.26 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-5-methyl-1,3-dioxane is sourced from PubChem (CID 21890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).