C11H16N8S2 — CID 2189313
2-[3-(4,6-diaminopyrimidin-2-yl)sulfanylpropylsulfanyl]pyrimidine-4,6-diamine (PubChem CID 2189313) has the molecular formula C11H16N8S2 and a molecular weight of 324.44 g/mol. Its IUPAC name is 2-[3-(4,6-diaminopyrimidin-2-yl)sulfanylpropylsulfanyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[3-(4,6-diaminopyrimidin-2-yl)sulfanylpropylsulfanyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 2189313 |
| Molecular Formula | C11H16N8S2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[3-(4,6-diaminopyrimidin-2-yl)sulfanylpropylsulfanyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCCCSc2nc(N)cc(N)n2)n1 |
| InChI | InChI=1S/C11H16N8S2/c12-6-4-7(13)17-10(16-6)20-2-1-3-21-11-18-8(14)5-9(15)19-11/h4-5H,1-3H2,(H4,12,13,16,17)(H4,14,15,18,19) |
| InChIKey | XXMBOCLOWCXOGG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|